| N-Methyl-N-(N,N-dimethylaminoethyl)-aminoethanol Basic information |
| Product Name: |
N-Methyl-N-(N,N-dimethylaminoethyl)-aminoethanol |
| Synonyms: |
N,N,N'-Trimethyl-N'-(2-hydroxyethyl)-1,2-ethanediamine;N-[2-(Dimethylamino)ethyl]-N-methylethanolamine;CATALYST JD-36;N,N,N''-Trimethyl-N''-(2-hydroxyethyl)-ethylenediamine;DABCO T;2-[Methyl[2-(dimethylamino)ethyl]amino]ethanol;N,N,N′-trieMthylaMinoethyl-N′-MethylaMinoehylanol;2-[[2-(dimethylamino)ethyl]methylamino]etanol |
| CAS: |
2212-32-0 |
| MF: |
C7H18N2O |
| MW: |
146.23 |
| EINECS: |
218-658-4 |
| Product Categories: |
Excellent fogging performance and PVC staining performance;Amino Alcohols;Organic Building Blocks;Oxygen Compounds |
| Mol File: |
2212-32-0.mol |
 |
| |
| N-Methyl-N-(N,N-dimethylaminoethyl)-aminoethanol Chemical Properties |
| Boiling point |
207 °C(lit.) |
| density |
0.904 g/mL at 25 °C(lit.) |
| vapor pressure |
58Pa at 25℃ |
| refractive index |
n20/D 1.4539(lit.) |
| Fp |
188 °F |
| storage temp. |
Refrigerator |
| solubility |
Chloroform, Methanol (Slightly) |
| pka |
14.72±0.10(Predicted) |
| form |
Oil |
| color |
Colourless to Yellow |
| Water Solubility |
1000g/L at 20℃ |
| InChI |
InChI=1S/C7H18N2O/c1-8(2)4-5-9(3)6-7-10/h10H,4-7H2,1-3H3 |
| InChIKey |
LSYBWANTZYUTGJ-UHFFFAOYSA-N |
| SMILES |
C(O)CN(CCN(C)C)C |
| LogP |
-0.584 at 22.2℃ |
| NIST Chemistry Reference |
N-Methyl-N-(N,N-dimethylaminoethyl)-aminoethanol(2212-32-0) |
| EPA Substance Registry System |
Ethanol, 2-[[2-(dimethylamino)ethyl]methylamino]- (2212-32-0) |
| Hazard Codes |
Xi |
| Risk Statements |
36/37/38 |
| Safety Statements |
26-36/37/39 |
| WGK Germany |
3 |
| HS Code |
2922.19.9690 |
| Provider |
Language |
| SigmaAldrich |
English |
| |
| N-Methyl-N-(N,N-dimethylaminoethyl)-aminoethanol Usage And Synthesis |
| Chemical Properties |
Colorless to pale yellow transparent liquid |
| Uses |
2-{[2-(Dimethylamino)ethyl]methylamino}ethanol (dmemH) has been used in the preparation of new iron clusters:
[Fe7O4(O2CPh)11(dmem)2]
[Fe7O4 (O2CMe)11(dmem)2]
[Fe6O2(OH)4(O2CBut)8(dmem)2]
|
| Flammability and Explosibility |
Not classified |
| |
| N-Methyl-N-(N,N-dimethylaminoethyl)-aminoethanol Preparation Products And Raw materials |
| Raw materials |
2-Methylaminoethanol-->Formaldehyde-->2-(2-Aminoethylamino)ethanol |
Hot Tags: n-methyl-n-(n,n-dimethylaminoethyl)-aminoethanol, China n-methyl-n-(n,n-dimethylaminoethyl)-aminoethanol manufacturers, suppliers, factory, CAS 32360 05 7, CAS 3290 92 4, 5 ethyl 1 3 dioxan 5 yl methyl Acrylate, CAS 84170 74 1, Trimethylolpropane Trimethacrylate, 26570-48-9
