| Potassium 2-ethylhexanoate Basic information |
| Product Name: |
Potassium 2-ethylhexanoate |
| Synonyms: |
Potassium 2-ethylhexanoate, 99.9% (metals basis), 75% w/w soln.;PotassiuM 2-ethyl hexanote;PotassiuM 2-Ethyl hexanoate hydratate;Kalium Octoate;Potassium 2-ethylhexanoate solution, 75 wt. % solution, 99.9% trace metals basis;2-ethyl-hexanoicacipotassiumsalt;2-ETHYLHEXANOIC ACID POTASSIUM SALT;POTASSIUM 2-ETHYLHEXANOATE |
| CAS: |
3164-85-0 |
| MF: |
C8H17KO2 |
| MW: |
184.32 |
| EINECS: |
221-625-7 |
| Product Categories: |
metal carboxylate;75% potassium octoate or diethylene glycol |
| Mol File: |
3164-85-0.mol |
 |
| |
| Potassium 2-ethylhexanoate Chemical Properties |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
solid |
| color |
slightly yellow, glassy |
| Water Solubility |
Partly miscible with water. |
| Sensitive |
Moisture Sensitive |
| InChI |
InChI=1S/C8H16O2.K/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1 |
| InChIKey |
ZUFQCVZBBNZMKD-UHFFFAOYSA-M |
| SMILES |
[K+].C([O-])(=O)C(CC)CCCC |
| CAS DataBase Reference |
3164-85-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Potassium 2-ethylhexanoate (3164-85-0) |
| Risk Statements |
36/37/38 |
| Safety Statements |
26-36/37/39 |
| HS Code |
2915.90.5050 |
| Provider |
Language |
| ALFA |
English |
| |
| Potassium 2-ethylhexanoate Usage And Synthesis |
| Uses |
Polyester and Isocyanurate foam initiator |
| Uses |
Potassium Hex-Cem can be used as phase-transfer active trimerization catalyst salts. |
| Flammability and Explosibility |
Non flammable |
| |
| Potassium 2-ethylhexanoate Preparation Products And Raw materials |
| Raw materials |
Ethanol-->Potassium carbonate-->Potassium hydroxide-->2-Ethylhexanoic acid-->Isooctanoic acid |
Hot Tags: potassium 2-ethylhexanoate, China potassium 2-ethylhexanoate manufacturers, suppliers, factory, CAS 57472 68 1, CAS 9004 74 4, Mono-functional, Ethoxylated 3 Trimethylolpropane Triacrylate, Trimethylolpropane Trimethacrylate, Trimethylolpropane Triacrylate
